9-cis-Retinol (BioCAD00000005609)
{$topic}
Metabolite Card
Formula: C20H30O (286.2297)
SMILES: C\C(=C/CO)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C
Synonyms [en]
9-cis-Retinol; 9Z-retinol; (9cis)-retinol; (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol; 9-cis retinol; Retinol, 9-cis-
Last reviewed on 2024-06-28.
Cite this Page
9-cis-Retinol. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000005609). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
9-cis-retinol is a retinoid. Retinoids (vitamin A and its analogs) are essential dietary substances that are needed by mammals for reproduction, normal embryogenesis, growth, vision, and maintaining normal cellular differentiation and the integrity of the immune system. Within cells, retinoids regulate gene transcription acting through ligand-dependent transcription factors, the retinoic acid receptors (RARs), and the retinoid X receptors (RXRs). All-trans-retinoic acid binds only to RARs with high affinity, whereas its 9-cis isomer binds with high affinity to both RARs and RXRs. The actions of all-trans- and 9-cis-retinoic acid in regulating cellular responses are distinct and not interchangeable. (PMID: 9115228).
DBLinks
- CAS Registry Number: 22737-97-9
- PubChem CID: 9947823
- ChEBI: 78272
- HMDB: HMDB0006217
- LipidMaps: LMPR01090009
- KEGG: C16682
- BioCyc:
- NCBI MeSH:
- Wikipedia:
Other DBLinks
- CAS Registry Number: 22737-97-9
- PubChem: 9947823
- ChEBI: ChEBI:78272
- HMDB: HMDB0006217
- LipidMaps: LMPR01090009
- KEGG: C16682
- RefMet: RM0135416
- MoNA: HMDB0006217_ms_ms_1218230
- MoNA: HMDB0006217_ms_ms_1218231
- MoNA: HMDB0006217_ms_ms_1218232
- Metlin: METLIN_41505
Class / Ontology
- WishartLab ClassyFire: [Retinoids] Retinoids
- RefMet: [Retinoids] Retinoids
- LipidMaps: [Retinoids [PR0109]] Retinoids [PR0109]
- ChEBI: [CHEBI:78272] 9-cis-retinol
| ID | EC Number | Name |
|---|---|---|
| KEGG:R08382 | 1.1.1.315 | 9-cis-retinol:NAD+ oxidoreductase |
| KEGG:R08383 | 1.1.1.- | C16682 + C00006<=>C16681 + C00005 + C00080 |
| Rhea:RHEA:42053 | 9-cis-retinol + NAD+ => 9-cis-retinal + NADH + H+ | |
| Rhea:RHEA:42054 | 9-cis-retinal + NADH + H+ => 9-cis-retinol + NAD+ | |
| Rhea:RHEA:42055 | 9-cis-retinol + NAD+ <=> 9-cis-retinal + NADH + H+ | |
| Rhea:RHEA:54917 | 9-cis-retinol + NADP+ => 9-cis-retinal + NADPH + H+ | |
| Rhea:RHEA:54918 | 9-cis-retinal + NADPH + H+ => 9-cis-retinol + NADP+ | |
| Rhea:RHEA:54919 | 9-cis-retinol + NADP+ <=> 9-cis-retinal + NADPH + H+ | |
| Rhea:RHEA:55277 | 9-cis-retinol + tetradecanoyl-CoA => 9-cis-retinyl tetradecanoate + CoA | |
| Rhea:RHEA:55278 | 9-cis-retinyl tetradecanoate + CoA => 9-cis-retinol + tetradecanoyl-CoA | |
| Rhea:RHEA:55279 | 9-cis-retinol + tetradecanoyl-CoA <=> 9-cis-retinyl tetradecanoate + CoA | |
| Rhea:RHEA:55329 | 9-cis-retinol + hexadecanoyl-CoA => 9-cis-retinyl hexadecanoate + CoA | |
| Rhea:RHEA:55330 | 9-cis-retinyl hexadecanoate + CoA => 9-cis-retinol + hexadecanoyl-CoA | |
| Rhea:RHEA:55331 | 9-cis-retinol + hexadecanoyl-CoA <=> 9-cis-retinyl hexadecanoate + CoA | |
| Rhea:RHEA:55349 | all-trans-retinol => 9-cis-retinol | |
| Rhea:RHEA:55350 | 9-cis-retinol => all-trans-retinol | |
| Rhea:RHEA:55351 | all-trans-retinol <=> 9-cis-retinol | |
| Rhea:RHEA:55361 | 11-cis-retinol => 9-cis-retinol | |
| Rhea:RHEA:55362 | 9-cis-retinol => 11-cis-retinol | |
| Rhea:RHEA:55363 | 11-cis-retinol <=> 9-cis-retinol |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| WikiPathways:WP5188 | Retinol metabolism |
| WikiPathways:WP1038 | Vitamin A and carotenoid metabolism |
| WikiPathways:WP716 | Vitamin A and carotenoid metabolism |
| WikiPathways:WP3843 | Vitamin A and carotenoid metabolism |
| PathBank:SMP0120500 | Vitamin A Deficiency |
| PathBank:SMP0087510 | Retinol Metabolism |
| PathBank:SMP0087353 | Retinol Metabolism |
| PathBank:SMP0120720 | Vitamin A Deficiency |
| PathBank:SMP0000074 | Retinol Metabolism |
| PathBank:SMP0000336 | Vitamin A Deficiency |
| PathBank:SMP0087260 | Retinol Metabolism |
| PathBank:SMP0087412 | Retinol Metabolism |
| PathBank:SMP0063662 | Retinol Metabolism |