beta-D-Xylose (BioCAD00000007336)
{$topic}
Metabolite Card
Formula: C5H10O5 (150.0528)
SMILES: O[C@@H]1CO[C@@H](O)[C@H](O)[C@H]1O
Synonyms [en]
beta-D-Xylose; BETA-D-XYLOPYRANOSE; (1->4)-beta-D-xylopyranan; .BETA.-D-XYLOSE; beta-Xylopyranose; (1->4)-beta-D-xylan
Last reviewed on 2024-06-28.
Cite this Page
beta-D-Xylose. 数据之源，洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000007336). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
D-Xylopyranose in which the anomeric configuration is beta." []
Class / Ontology
- ChEBI: [CHEBI:28161] beta-D-xylose
- Coconut NaturalProduct: [Monosaccharides] Monosaccharides
| ID | EC Number | Name |
|---|---|---|
| Rhea:RHEA:63337 | 5.1.3.3 | α-D-xylose => β-D-xylose |
| Rhea:RHEA:63338 | 5.1.3.3 | β-D-xylose => α-D-xylose |
| Rhea:RHEA:63339 | 5.1.3.3 | α-D-xylose <=> β-D-xylose |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:ARA_PWY-5800 | xylan biosynthesis |
| BioCyc:SHIGELLA_PWY-6784 | cellulose and hemicellulose degradation (cellulolosome) |
| BioCyc:EREC_PWY-6784 | cellulose and hemicellulose degradation (cellulolosome) |
| BioCyc:META_PWY-6717 | (1,4)-β-D-xylan degradation |
| BioCyc:META_PWY-5800 | xylan biosynthesis |
| BioCyc:ARA_PWY-6717 | (1,4)-β-xylan degradation |
| BioCyc:AGRO_PWY-6717 | (1,4)-β-D-xylan degradation |
| BioCyc:THAPS_PWY-6717 | (1,4)-β-xylan degradation |
| BioCyc:BTHE_PWY-6784 | cellulose and hemicellulose degradation (cellulolosome) |
| BioCyc:META_PWY-6789 | (1,3)-β-D-xylan degradation |
| BioCyc:META_PWY-6784 | cellulose and hemicellulose degradation (cellulolosome) |
| BioCyc:AURANTIMONAS_PWY-6717 | (1,4)-β-D-xylan degradation |
| BioCyc:CLOSSAC_PWY-6717 | (1,4)-β-xylan degradation |
| BioCyc:CLOSSAC_PWY-6784 | superpathway of cellulose and hemicellulose degradation (cellulolosome) |
| PathBank:SMP0002117 | Xylose Degradation I |
| Plant Reactome:R-OAU-2744345 | Metabolism and regulation |
| Plant Reactome:R-OAU-2883407 | Carbohydrate metabolism |
| Plant Reactome:R-TAE-2883407 | Carbohydrate metabolism |
| Plant Reactome:R-MES-2744345 | Metabolism and regulation |
| Plant Reactome:R-MES-5654909 | Xylan biosynthesis |