7alpha,12alpha-Dihydroxy-5beta-cholestan-3-one (BioCAD00000005489)
{$topic}
Metabolite Card
Formula: C27H46O3 (418.3447)
SMILES: C1[C@]2(C)[C@@]3([H])C[C@H](O)[C@]4(C)[C@@]([H])([C@]([H])(C)CCCC(C)C)CC[C@@]4([H])[C@]3([H])[C@H](O)C[C@]2([H])CC(=O)C1
Synonyms [en]
7alpha,12alpha-Dihydroxy-5beta-cholestan-3-one; 5beta-Cholesten-7alpha,12alpha-diol-3-one; 5beta-cholestane-7alpha,12alpha-diol-3-one; UNII-JXG7DN7KC6; JXG7DN7KC6; (5beta
Last reviewed on 2024-06-28.
Cite this Page
7alpha,12alpha-Dihydroxy-5beta-cholestan-3-one. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000005489). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
7alpha,12alpha-Dihydroxy-5beta-cholestan-3-one
DBLinks
- CAS Registry Number: 547-97-7
- PubChem CID: 5284271
- ChEBI: 2288
- HMDB: HMDB0006887
- LipidMaps: LMST04030113
- KEGG: C05453
- BioCyc: CPD-10503
- NCBI MeSH:
- Wikipedia:
Other DBLinks
- CAS Registry Number: 547-97-7
- PubChem: 5284271
- ChEBI: ChEBI:2288
- HMDB: HMDB0006887
- HMDB: HMDB06886
- LipidMaps: LMST04030113
- KEGG: C05453
- BioCyc: CPD-10503
- RefMet: RM0126121
- Metlin: METLIN_43117
- Coconut NaturalProduct: CNP0347053.1
- Coconut NaturalProduct: CNP0347053.4
Class / Ontology
| ID | EC Number | Name |
|---|---|---|
| KEGG:R04823 | 1.3.1.3 | 7alpha,12alpha-dihydroxy-5beta-cholestan-3-one:NADP+ delta4-oxidoreductase |
| KEGG:R04824 | 1.1.1.50 | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholestane:NAD+ oxidoreductase (B-specific) |
| KEGG:R04825 | 1.1.1.50 | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholestane:NADP+ oxidoreductase (B-specific) |
| Rhea:RHEA:46633 | 7α,12α-dihydroxycholest-4-en-3-one + NADPH + H+ => 7α,12α-dihydroxy-5β-cholestan-3-one + NADP+ | |
| Rhea:RHEA:46634 | 7α,12α-dihydroxy-5β-cholestan-3-one + NADP+ => 7α,12α-dihydroxycholest-4-en-3-one + NADPH + H+ | |
| Rhea:RHEA:46635 | 7α,12α-dihydroxycholest-4-en-3-one + NADPH + H+ <=> 7α,12α-dihydroxy-5β-cholestan-3-one + NADP+ | |
| BioCyc:RXN-9794 | 1.3.1.3 | CPD-7237 + NADPH + PROTON --> CPD-10503 + NADP |
| BioCyc:RXN-9796 | 1.1.1.213 | 5β-cholestane-3α,7α,12α-triol 3-dehydrogenase |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:MOUSE_PWY-6061 | bile acid biosynthesis, neutral pathway |
| Reactome:R-BTA-1430728 | Metabolism |
| Reactome:R-BTA-556833 | Metabolism of lipids |
| Reactome:R-BTA-194068 | Bile acid and bile salt metabolism |
| Reactome:R-CEL-194068 | Bile acid and bile salt metabolism |
| Reactome:R-CFA-1430728 | Metabolism |
| Reactome:R-CFA-556833 | Metabolism of lipids |
| Reactome:R-CFA-194068 | Bile acid and bile salt metabolism |
| Reactome:R-DDI-192105 | Synthesis of bile acids and bile salts |
| Reactome:R-DME-194068 | Bile acid and bile salt metabolism |
| Reactome:R-GGA-194068 | Bile acid and bile salt metabolism |
| Reactome:R-HSA-194068 | Bile acid and bile salt metabolism |
| Reactome:R-MMU-1430728 | Metabolism |
| Reactome:R-MMU-556833 | Metabolism of lipids |
| Reactome:R-MMU-8957322 | Metabolism of steroids |
| Reactome:R-RNO-193368 | Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| Reactome:R-SCE-8957322 | Metabolism of steroids |
| Reactome:R-SCE-194068 | Bile acid and bile salt metabolism |
| Reactome:R-SPO-1430728 | Metabolism |
| Reactome:R-SSC-193368 | Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |