Metabolite Card
Formula: C27H44O2 (400.3341)
SMILES: [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)CC4=CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C
Synonyms [en]
7alpha-Hydroxycholest-4-en-3-one; 7alpha-Hydroxy-4-cholesten-3-one; Cholest-4-en-7alpha-ol-3-one; 7 alpha-3ox-C; 7-hydroxy-4-cholesten-3-one; 7a-Hydroxy-4-cholesten-3-one-12alpha
Last reviewed on 2024-06-28.
Cite this Page
7alpha-Hydroxycholest-4-en-3-one. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000005477). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
7a-Hydroxy-cholestene-3-one is a metabolite in bile acid synthesis. It is derived from 7a-hydroxy-cholesterol and can be further metabolized to 7a,12a,-dihydroxy-cholest-4-en-3-one. Analysis of 7a-Hydroxycholestene-3-one (HCO) in serum may serve as a novel, simple, and sensitive method for the detection of bile acid malabsorption in patients with chronic diarrhea of unknown origin (PMID 9952217).
DBLinks
- CAS Registry Number: 3862-25-7
- PubChem CID: 123743
- ChEBI: 17899
- HMDB: HMDB0001993
- LipidMaps: LMST04030123
- KEGG: C05455
- BioCyc: CPD-1087
- NCBI MeSH: 7 alpha-hydroxy-4-cholesten-3-one
- Wikipedia: 7%CE%B1-Hydroxy-4-cholesten-3-one
Other DBLinks
- CAS Registry Number: 3862-25-7
- PubChem: 123743
- ChEBI: ChEBI:17899
- HMDB: HMDB0001993
- HMDB: HMDB01993
- LipidMaps: LMST04030123
- KEGG: C05455
- BioCyc: CPD-1087
- NCBI MeSH: 7 alpha-hydroxy-4-cholesten-3-one
- Wikipedia: 7%CE%B1-Hydroxy-4-cholesten-3-one
- RefMet: RM0128379
- MoNA: CCMSLIB00005465954
- MoNA: CCMSLIB00005465955
- MoNA: CCMSLIB00005465956
- MoNA: CCMSLIB00005465957
- MoNA: CCMSLIB00005465958
- Metlin: METLIN_43126
- Coconut NaturalProduct: CNP0111476.1
Class / Ontology
- WishartLab ClassyFire: [Cholestane steroids] Cholestane steroids
- RefMet: [C27 bile acids] C27 bile acids
- LipidMaps: [C27 bile acids, alcohols, and derivatives [ST0403]] C27 bile acids, alcohols, and derivatives [ST0403]
- ChEBI: [CHEBI:17899] 7alpha-hydroxycholest-4-en-3-one
- Coconut NaturalProduct: [Cholestane steroids] Cholestane steroids
| ID | EC Number | Name |
|---|---|---|
| KEGG:R04263 | 1.1.1.181 | 7alpha-hydroxycholesterol:NAD+ 3-oxidoreductase |
| KEGG:R04264 | 1.1.1.181 | cholest-5-ene-3beta,7alpha-diol:NAD+ 3-oxidoreductase |
| KEGG:R04817 | 1.3.1.3 | 7alpha-hydroxy-5beta-cholestan-3-one:NADP+ delta4-oxidoreductase |
| KEGG:R04826 | 1.14.14.139 | 7alpha-hydroxycholest-4-en-3-one,[reduced NADPH---hemoprotein reductase]:oxygen oxidoreductase (12alpha-hydroxylating) |
| Rhea:RHEA:11897 | 1.1.1.181 | 7α-hydroxycholesterol + NAD+ => 7α-hydroxycholest-4-en-3-one + NADH + H+ |
| Rhea:RHEA:11898 | 1.1.1.181 | 7α-hydroxycholest-4-en-3-one + NADH + H+ => 7α-hydroxycholesterol + NAD+ |
| Rhea:RHEA:11899 | 1.1.1.181 | 7α-hydroxycholesterol + NAD+ <=> 7α-hydroxycholest-4-en-3-one + NADH + H+ |
| Rhea:RHEA:46641 | 7α-hydroxycholest-4-en-3-one + NADPH + H+ => 7α-hydroxy-5β-cholestan-3-one + NADP+ | |
| Rhea:RHEA:46642 | 7α-hydroxy-5β-cholestan-3-one + NADP+ => 7α-hydroxycholest-4-en-3-one + NADPH + H+ | |
| Rhea:RHEA:46643 | 7α-hydroxycholest-4-en-3-one + NADPH + H+ <=> 7α-hydroxy-5β-cholestan-3-one + NADP+ | |
| Rhea:RHEA:46753 | 1.14.14.139 | 7α-hydroxycholest-4-en-3-one + reduced [NADPH—hemoprotein reductase] + O2 => 7α,12α-dihydroxycholest-4-en-3-one + oxidized [NADPH—hemoprotein reductase] + H2O + H+ |
| Rhea:RHEA:46754 | 1.14.14.139 | 7α,12α-dihydroxycholest-4-en-3-one + oxidized [NADPH—hemoprotein reductase] + H2O + H+ => 7α-hydroxycholest-4-en-3-one + reduced [NADPH—hemoprotein reductase] + O2 |
| Rhea:RHEA:46755 | 1.14.14.139 | 7α-hydroxycholest-4-en-3-one + reduced [NADPH—hemoprotein reductase] + O2 <=> 7α,12α-dihydroxycholest-4-en-3-one + oxidized [NADPH—hemoprotein reductase] + H2O + H+ |
| BioCyc:RXN-9840 | 1.3.1.3 | CPD-1087 + NADPH + PROTON --> CPD-10548 + NADP |
| BioCyc:1.1.1.181-RXN | 1.1.1.181 | CPD-266 + NAD --> CPD-1087 + NADH + PROTON |
| BioCyc:1.14.13.95-RXN | 1.14.14.139 | CPD-1087 + Red-NADPH-Hemoprotein-Reductases + OXYGEN-MOLECULE --> CPD-7237 + Ox-NADPH-Hemoprotein-Reductases + WATER |
Taxonomy Source
- Dendronephthya gigantea [ncbi taxid: 151771]
- Homo sapiens [ncbi taxid: 9606]
- Mus musculus [ncbi taxid: 10090]
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:MOUSE_PWY-6061 | bile acid biosynthesis, neutral pathway |
| Reactome:R-BTA-1430728 | Metabolism |
| Reactome:R-BTA-556833 | Metabolism of lipids |
| Reactome:R-BTA-194068 | Bile acid and bile salt metabolism |
| Reactome:R-CEL-194068 | Bile acid and bile salt metabolism |
| Reactome:R-CFA-1430728 | Metabolism |
| Reactome:R-CFA-556833 | Metabolism of lipids |
| Reactome:R-CFA-194068 | Bile acid and bile salt metabolism |
| Reactome:R-CFA-211976 | Endogenous sterols |
| Reactome:R-DRE-193368 | Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| Reactome:R-DRE-211897 | Cytochrome P450 - arranged by substrate type |
| Reactome:R-DDI-192105 | Synthesis of bile acids and bile salts |
| Reactome:R-DME-194068 | Bile acid and bile salt metabolism |
| Reactome:R-GGA-194068 | Bile acid and bile salt metabolism |
| Reactome:R-GGA-211976 | Endogenous sterols |
| Reactome:R-HSA-194068 | Bile acid and bile salt metabolism |
| Reactome:R-HSA-211859 | Biological oxidations |
| Reactome:R-HSA-211994 | Sterols are 12-hydroxylated by CYP8B1 |
| Reactome:R-MMU-1430728 | Metabolism |
| Reactome:R-MMU-556833 | Metabolism of lipids |