3-Keto-4-methylzymosterol (BioCAD00000003611)
{$topic}
Metabolite Card
Formula: C28H44O (396.3392)
SMILES: C[C@H](CCC=C(C)C)C1CCC2C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)C1CC3
Synonyms [en]
3-Keto-4-methylzymosterol; 3-dehydro-4-methylzymosterol; 4-methyl-5alpha-cholesta-8,24-dien-3-one; (5alpha)-4-methylcholesta-8,24-dien-3-one; 13-dimethyl-17-(2R)-6-methyl-5-methylideneheptan-2-yl-4; 24-dien-3-one
Last reviewed on 2024-06-28.
Cite this Page
3-Keto-4-methylzymosterol. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000003611). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
3-Keto-4-methylzymosterol is an intermediate in the biosynthesis of steroids (KEGG:C15816). It is the 8th to last step in the synthesis of vitamin D2 and is converted from 4-methtylzymosterol-carboxylate via the enzyme sterol-4alpha-carboxylate 3-dehydrogenase (decarboxylating) (EC:1.1.1.170). It is then converted to 4-methylzymosterol via the enzyme 3-keto steroid reductase (EC:1.1.1.270).
DBLinks
- CAS Registry Number: 7377-73-3
- PubChem CID: 53477900
- ChEBI: 181923
- HMDB: HMDB0006838
- LipidMaps: LMST01010167
- KEGG: C15816
- BioCyc: CPD-4578
- NCBI MeSH:
- Wikipedia:
Other DBLinks
- CAS Registry Number: 7377-73-3
- PubChem: 24906328
- PubChem: 53477900
- ChEBI: ChEBI:181923
- ChEBI: ChEBI:505093
- ChEBI: ChEBI:50593
- HMDB: HMDB0006838
- LipidMaps: LMST01010167
- KEGG: C15816
- BioCyc: CPD-4578
- RefMet: RM0189043
- Coconut NaturalProduct: CNP0243509.1
- Coconut NaturalProduct: CNP0243509.2
- Coconut NaturalProduct: CNP0243509.3
- Coconut NaturalProduct: CNP0321294.2
Class / Ontology
- WishartLab ClassyFire: [Cholestane steroids] Cholestane steroids
- RefMet: [Cholesterols] Cholesterols
- LipidMaps: [Cholesterol and derivatives [ST0101]] Cholesterol and derivatives [ST0101]
- ChEBI: [CHEBI:50593] 3-dehydro-4-methylzymosterol
- ChEBI: [CHEBI:181923] (5S,10S,13R)-4,10,13-trimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,4,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
- Coconut NaturalProduct: [Cholestane steroids] Cholestane steroids
- Coconut NaturalProduct: [Ergostane steroids] Ergostane steroids
| ID | EC Number | Name |
|---|---|---|
| KEGG:R07494 | 1.1.1.170 | C15808 + C00006<=>C15816 + C00005 + C00080 + C00011 |
| KEGG:R07495 | 1.1.1.270 | 4alpha-methylzymosterol:NADP+ 3-oxidoreductase |
| Rhea:RHEA:33448 | 1.1.1.170 | 4β-methylzymosterol-4α-carboxylate + NADP+ => 3-dehydro-4-methylzymosterol + CO2 + NADPH |
| Rhea:RHEA:33449 | 1.1.1.170 | 3-dehydro-4-methylzymosterol + CO2 + NADPH => 4β-methylzymosterol-4α-carboxylate + NADP+ |
| Rhea:RHEA:33450 | 1.1.1.170 | 4β-methylzymosterol-4α-carboxylate + NADP+ <=> 3-dehydro-4-methylzymosterol + CO2 + NADPH |
| Rhea:RHEA:47161 | 4β-methylzymosterol-4α-carboxylate + NAD+ => 3-dehydro-4-methylzymosterol + CO2 + NADH | |
| Rhea:RHEA:47162 | 3-dehydro-4-methylzymosterol + CO2 + NADH => 4β-methylzymosterol-4α-carboxylate + NAD+ | |
| Rhea:RHEA:47163 | 4β-methylzymosterol-4α-carboxylate + NAD+ <=> 3-dehydro-4-methylzymosterol + CO2 + NADH | |
| BioCyc:RXN-20373 | 1.1.1.418 | CPD-4577 + NAD --> CPD-4578 + NADH + CARBON-DIOXIDE |
| BioCyc:RXN66-313 | 1.1.1.170 | CPD-4577 + NAD-P-OR-NOP --> CPD-4578 + NADH-P-OR-NOP + CARBON-DIOXIDE |
| BioCyc:RXN-20116 | 1.1.1.417 | CPD-21730 + NAD-P-OR-NOP --> CPD-4578 + NADH-P-OR-NOP + CARBON-DIOXIDE |
| BioCyc:RXN66-314 | 1.1.1.270 | PROTON + CPD-4578 + NADPH --> 4-METHYL-824-CHOLESTADIENOL + NADP |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| PlantCyc:PLANT_PWY66-341 | cholesterol biosynthesis I |
| PlantCyc:PLANT_PWY-6074 | zymosterol biosynthesis |
| PathBank:SMP0120794 | Mevalonic Aciduria |
| PathBank:SMP0120464 | CHILD Syndrome |
| PathBank:SMP0120472 | Desmosterolosis |
| PathBank:SMP0120512 | Lysosomal Acid Lipase Deficiency (Wolman Disease) |
| PathBank:SMP0120573 | Cholesteryl Ester Storage Disease |
| PathBank:SMP0121057 | Bloch Pathway (Cholesterol Biosynthesis) |
| PathBank:SMP0000023 | Steroid Biosynthesis |
| PathBank:SMP0000387 | CHILD Syndrome |
| PathBank:SMP0000112 | Risedronate Action Pathway |
| PathBank:SMP0000508 | Cholesteryl Ester Storage Disease |
| PathBank:SMP0002438 | Cholesterol Biosynthesis and Metabolism CE(12:0) |
| PathBank:SMP0087326 | Steroid Biosynthesis |
| PathBank:SMP0120685 | Chondrodysplasia Punctata II, X-Linked Dominant (CDPX2) |
| PathBank:SMP0120769 | Hypercholesterolemia |
| PathBank:SMP0120793 | Hyper-IgD Syndrome |
| PathBank:SMP0120515 | Smith-Lemli-Opitz Syndrome (SLOS) |
| PathBank:SMP0120576 | Wolman Disease |
| PathBank:SMP0000389 | Smith-Lemli-Opitz Syndrome (SLOS) |