11beta-Hydroxyandrost-4-ene-3,17-dione (BioCAD00000001835)
{$topic}
Metabolite Card
Formula: C19H26O3 (302.1882)
SMILES: [C@]12([H])[C@@H](O)C[C@]3(C)C(CC[C@@]3([H])[C@]1([H])CCC1=CC(CC[C@]21C)=O)=O
Synonyms [en]
11beta-Hydroxyandrost-4-ene-3,17-dione; 4-Androsten-11beta-ol-3,17-dione; 11beta-Hydroxyandrostenedione; Androst-4-ene-3,17-dione-11beta-ol; UNII-41G81C896T; 11beta-Hydroxy-4-androstene-3,17-dione
Last reviewed on 2024-06-28.
Cite this Page
11beta-Hydroxyandrost-4-ene-3,17-dione. 数据之源，洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000001835). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
11beta-Hydroxyandrostenedione
DBLinks
- CAS Registry Number: 382-44-5
- PubChem CID: 94141
- ChEBI: 190716
- HMDB: HMDB0006773
- LipidMaps: LMST02020066
- KEGG: C05284
- BioCyc:
- NCBI MeSH:
- Wikipedia: 11%CE%B2-Hydroxyandrostenedione
Other DBLinks
- CAS Registry Number: 382-44-5
- CAS Registry Number: 564-33-0
- PubChem: 94141
- ChEBI: ChEBI:190716
- ChEBI: ChEBI:27967
- HMDB: HMDB0006773
- HMDB: HMDB06773
- LipidMaps: LMST02020066
- KEGG: C05284
- Wikipedia: 11%CE%B2-Hydroxyandrostenedione
- RefMet: RM0135764
- MoNA: AU282901
- MoNA: AU282902
- MoNA: AU282903
- MoNA: AU282904
- MoNA: AU282905
- MoNA: AU282906
- Metlin: METLIN_41861
- Coconut NaturalProduct: CNP0165308.2
- Coconut NaturalProduct: CNP0165308.6
Class / Ontology
- RefMet: [C19 steroids] C19 steroids
- LipidMaps: [C19 steroids (androgens) and derivatives [ST0202]] C19 steroids (androgens) and derivatives [ST0202]
- ChEBI: [CHEBI:190716] 11b-Hydroxyandrost-4-ene-3,17-dione
- ChEBI: [CHEBI:27967] 11beta-hydroxyandrost-4-ene-3,17-dione
- Coconut NaturalProduct: [Androstane steroids] Androstane steroids
| ID | EC Number | Name |
|---|---|---|
| KEGG:R02725 | 1.14.15.4 | androstenedione,reduced-adrenal-ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
| KEGG:R04758 | 1.1.1.146 | 11beta-hydroxyandrost-4-ene-3,17-dione:NADP+ 11-oxidoreductase |
| KEGG:R08945 | 1.1.1.62 | 11beta,17beta-dihydroxy-4-androsten-3-one:NAD+ 17-oxidoreductase |
| KEGG:R08980 | 1.1.1.62 | 11beta,17beta-dihydroxy-4-androsten-3-one:NADP+ 17-oxidoreductase |
| KEGG:R08995 | C00735<=>C05284 | |
| KEGG:R13460 | 1.14.14.32 | 21-deoxycortisol,NADPH---hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating, acetate-releasing) |
| Rhea:RHEA:53489 | 11β-hydroxyandrost-4-ene-3,17-dione + NADPH + H+ => 11β,17β-dihydroxyandrost-4-ene-3-one + NADP+ | |
| Rhea:RHEA:53490 | 11β,17β-dihydroxyandrost-4-ene-3-one + NADP+ => 11β-hydroxyandrost-4-ene-3,17-dione + NADPH + H+ | |
| Rhea:RHEA:53491 | 11β-hydroxyandrost-4-ene-3,17-dione + NADPH + H+ <=> 11β,17β-dihydroxyandrost-4-ene-3-one + NADP+ | |
| Rhea:RHEA:69409 | 11β-hydroxyandrost-4-ene-3,17-dione + NAD+ => androst-4-ene-3,11,17-trione + NADH + H+ | |
| Rhea:RHEA:69410 | androst-4-ene-3,11,17-trione + NADH + H+ => 11β-hydroxyandrost-4-ene-3,17-dione + NAD+ | |
| Rhea:RHEA:69411 | 11β-hydroxyandrost-4-ene-3,17-dione + NAD+ <=> androst-4-ene-3,11,17-trione + NADH + H+ | |
| Rhea:RHEA:84072 | androst-4-ene-3,17-dione + 2 reduced [adrenodoxin] + O2 + 2 H+ => 11β-hydroxyandrost-4-ene-3,17-dione + 2 oxidized [adrenodoxin] + H2O | |
| Rhea:RHEA:84073 | 11β-hydroxyandrost-4-ene-3,17-dione + 2 oxidized [adrenodoxin] + H2O => androst-4-ene-3,17-dione + 2 reduced [adrenodoxin] + O2 + 2 H+ | |
| Rhea:RHEA:84074 | androst-4-ene-3,17-dione + 2 reduced [adrenodoxin] + O2 + 2 H+ <=> 11β-hydroxyandrost-4-ene-3,17-dione + 2 oxidized [adrenodoxin] + H2O |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| PathBank:SMP0030406 | Androstenedione Metabolism |
| PathBank:SMP0087530 | Androstenedione Metabolism |
| PathBank:SMP0087421 | Androstenedione Metabolism |
| PathBank:SMP0087364 | Androstenedione Metabolism |
| PathBank:SMP0063688 | Androstenedione Metabolism |
| PathBank:SMP0087271 | Androstenedione Metabolism |