6alpha-hydroxyteasterone (BioCAD00000546261)
{$topic}
Metabolite Card
Formula: C28H50O4 (450.3709)
SMILES: [C@@]1([C@@H]([C@H]([C@@H]([C@H](C(C)C)C)O)O)C)([H])[C@]2(CC[C@]3([C@@](C[C@@H]([C@]4(C[C@H](CC[C@@]43C)O)[H])O)([C@@]2(CC1)[H])[H])[H])C
Synonyms [en]
6alpha-hydroxyteasterone; 6-hydroxyteasterone; (22r,23r,24s)-24-methyl-5alpha-cholestane-3beta,6alpha,22,23-tetraol; (3S,5S,6S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol
Last reviewed on 2024-06-28.
Cite this Page
6alpha-hydroxyteasterone. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000546261). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
6alpha-hydroxyteasterone is a 22-hydroxy steroid, a 23-hydroxy steroid, a 6alpha-hydroxy steroid, a brassinosteroid and a 3-hydroxy steroid.
Class / Ontology
| ID | EC Number | Name |
|---|---|---|
| Rhea:RHEA:69960 | 6-deoxoteasterone + reduced [NADPH—hemoprotein reductase] + O2 => 6α-hydroxyteasterone + oxidized [NADPH—hemoprotein reductase] + H2O + H+ | |
| Rhea:RHEA:69961 | 6α-hydroxyteasterone + oxidized [NADPH—hemoprotein reductase] + H2O + H+ => 6-deoxoteasterone + reduced [NADPH—hemoprotein reductase] + O2 | |
| Rhea:RHEA:69962 | 6-deoxoteasterone + reduced [NADPH—hemoprotein reductase] + O2 <=> 6α-hydroxyteasterone + oxidized [NADPH—hemoprotein reductase] + H2O + H+ | |
| BioCyc:RXN-16172 | 1.14.19.- | CPD-17421 + Red-NADPH-Hemoprotein-Reductases + OXYGEN-MOLECULE --> CPD-716 + Ox-NADPH-Hemoprotein-Reductases + 2 WATER |
| BioCyc:RXN-11536 | 1.14.14.- | CPD-715 + OXYGEN-MOLECULE + Red-NADPH-Hemoprotein-Reductases --> CPD-17421 + WATER + Ox-NADPH-Hemoprotein-Reductases |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:META_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| BioCyc:META_PWY-699 | brassinosteroid biosynthesis I |
| BioCyc:ARA_PWY-699 | brassinosteroid biosynthesis I |
| PlantCyc:SPIRODELA_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:AHALLERI_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:AMBORELLA_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:TOMATO_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:TPARVULA_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:BANANA_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:BARLEY_PWY-699 | brassinosteroid biosynthesis I |
| PlantCyc:BARLEY_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| PlantCyc:BOLERACEA_CAPITATA_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:BRACHYPODIUM_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| PlantCyc:BRAPA_FPSC_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:BSTRICTA_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:CGRANDIFLORA_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:CHINESECABBAGE_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:SPIDERFLOWER_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:CUCUMBER_PWY-699 | brassinolide biosynthesis I |
| PlantCyc:DROTUNDATA_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |