2-amino-2'-deoxyadenosine 5'-triphosphate(4-) (BioCAD00000476859)
{$topic}
Metabolite Card
Formula: C10H13N6O12P3 (501.9804)
SMILES: NC1=NC(=NC2=C1N=CN2[C@@H]3O[C@H](COP(=O)(OP(=O)(OP(=O)([O-])[O-])[O-])[O-])[C@@H](O)C3)N
Synonyms [en]
dZTP; 2-amino-2'-deoxyadenosine 5'-triphosphate(4-); 2-amino-2'-deoxyadenosine 5'-triphosphate
Last reviewed on 2024-06-28.
Cite this Page
2-amino-2'-deoxyadenosine 5'-triphosphate(4-). 数据之源，洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000476859). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
Back in 1977 it was discovered that the genome of |FRAME: TAX-260586| does not contain |FRAME: ADENINE| bases. Instead, the phage genome contains the nucleotide base |FRAME: CPD0-2060| (Z) |CITS: [413053][676082]|. |FRAME: CPD0-2060 2,6-Diaminopurine| forms three hydrogen bonds when base-paired with |FRAME: THYMINE| witihin the double helix DNA structure, changing the physical, chemical, and mechanical properties of the double stranded DNA |CITS: [3387218][8832386][30795872]|. As a result, the genomic DNA of |FRAME: TAX-260586| is resistant to all restriction enzymes whose recognition sequence involves adenine |CITS: [2820801][2829119][33926954]|.
Class / Ontology
| ID | EC Number | Name |
|---|---|---|
| Rhea:RHEA:67645 | dZDP + ATP => dZTP + ADP | |
| Rhea:RHEA:67646 | dZTP + ADP => dZDP + ATP | |
| Rhea:RHEA:67647 | dZDP + ATP <=> dZTP + ADP | |
| Rhea:RHEA:67729 | dZTP + DNA(n) => DNA(n)-Z + diphosphate | |
| Rhea:RHEA:67730 | DNA(n)-Z + diphosphate => dZTP + DNA(n) | |
| Rhea:RHEA:67731 | dZTP + DNA(n) <=> DNA(n)-Z + diphosphate | |
| BioCyc:RXN-22499 | 2.7.4.6 | ATP + CPD-24554 --> ADP + CPD-24555 |