3-(cis-5,6-dihydroxycyclohexa-1,3-dienyl)propanoate (BioCAD00000472809)
{$topic}
Metabolite Card
Formula: C9H11O4 (183.0657)
SMILES: O[C@@H]1C=CC=C(CCC([O-])=O)[C@@H]1O
Synonyms [en]
3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)propanoate; 3-(cis-5,6-dihydroxycyclohexa-1,3-dienyl)propanoate; 3-(cis-5,6-dihydroxycyclohexa-1,3-dienyl)propionate; 3-[rel-(5R,6S)-5,6-dihydroxycyclohexa-1,3-dien-1-yl]propanoate; 3-[(5R,6S)-5,6-dihydroxycyclohexa-1,3-dienyl]propionate; 3-[(5R,6S)-5,6-dihydroxycyclohexa-1,3-dien-1-yl]propanoate
Last reviewed on 2024-06-28.
Cite this Page
3-(cis-5,6-dihydroxycyclohexa-1,3-dienyl)propanoate. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000472809). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
The anion resulting from the removal of a proton from the carboxylic acid group of 3-(cis-5,6-dihydroxycyclohexa-1,3-dienyl)propanoic acid." []
Class / Ontology
| ID | EC Number | Name |
|---|---|---|
| Rhea:RHEA:20358 | 1.14.12.19 | 3-phenylpropanoate + NADH + O2 + H+ => 3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)propanoate + NAD+ |
| Rhea:RHEA:20359 | 1.14.12.19 | 3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)propanoate + NAD+ => 3-phenylpropanoate + NADH + O2 + H+ |
| Rhea:RHEA:20360 | 1.14.12.19 | 3-phenylpropanoate + NADH + O2 + H+ <=> 3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)propanoate + NAD+ |
| Rhea:RHEA:25063 | 1.3.1.87 | 3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)propanoate + NAD+ => 3-(2,3-dihydroxyphenyl)propanoate + NADH + H+ |
| Rhea:RHEA:25064 | 1.3.1.87 | 3-(2,3-dihydroxyphenyl)propanoate + NADH + H+ => 3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)propanoate + NAD+ |
| Rhea:RHEA:25065 | 1.3.1.87 | 3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)propanoate + NAD+ <=> 3-(2,3-dihydroxyphenyl)propanoate + NADH + H+ |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:META_HCAMHPDEG-PWY | 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation to 2-hydroxypentadienoate |
| BioCyc:ECOL316407_PWY0-1277 | 3-phenylpropionate and 3-(3-hydroxyphenyl)propionate degradation |
| BioCyc:ECOL413997_HCAMHPDEG-PWY | 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation to 2-oxopent-4-enoate |
| BioCyc:META_PWY0-1277 | 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation |
| BioCyc:SHIGELLA_HCAMHPDEG-PWY | 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation to 2-oxopent-4-enoate |
| BioCyc:ECO_HCAMHPDEG-PWY | 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation to 2-hydroxypentadienoate |
| BioCyc:ECOO157_HCAMHPDEG-PWY | 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation to 2-oxopent-4-enoate |
| BioCyc:ECO_PWY0-1277 | 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation |
| BioCyc:ECOO157_PWY0-1277 | 3-phenylpropionate and 3-(3-hydroxyphenyl)propionate degradation |
| BioCyc:ECOL316407_HCAMHPDEG-PWY | 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation to 2-oxopent-4-enoate |
| BioCyc:ECOL413997_PWY0-1277 | 3-phenylpropionate and 3-(3-hydroxyphenyl)propionate degradation |
| PathBank:SMP0002049 | 2-Oxopent-4-enoate Metabolism 2 |
| PathBank:SMP0122224 | 2-Oxopent-4-enoate Metabolism 2 |