3-epi-6-Deoxocathasterone (BioCAD00000003468)
{$topic}
Metabolite Card
Formula: C28H50O2 (418.3811)
SMILES: [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)[C@@H](O)C[C@@H](C)C(C)C)[C@@]4(C)CC[C@]3([H])[C@@]1(C)CC[C@@H](O)C2
Synonyms [en]
3-epi-6-Deoxocathasterone; 22-diol; LMST01031120; (3alpha,5alpha,22S,24R)-ergostane-3,22-diol; 22S-diol; 5alpha
Last reviewed on 2024-06-28.
Cite this Page
3-epi-6-Deoxocathasterone. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000003468). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
The 3-alpha-hydroxy epimer of 6-deoxocathasterone." []
DBLinks
- CAS Registry Number:
- PubChem CID: 45480560
- ChEBI: 59410
- HMDB: HMDB0304128
- LipidMaps: LMST01031120
- KEGG: C16251
- BioCyc: CPD-12493
- NCBI MeSH:
- Wikipedia:
Other DBLinks
- ChEBI: ChEBI:59410
- KEGG: C16251
- BioCyc: CPD-12493
- Metlin: METLIN_64136
- Coconut NaturalProduct: CNP0147051.4
Class / Ontology
- ChEBI: [CHEBI:59410] 3-epi-6-deoxocathasterone
- Coconut NaturalProduct: [Cholestane steroids] Cholestane steroids
| ID | EC Number | Name |
|---|---|---|
| KEGG:R07788 | C15797<=>C16251 | |
| KEGG:R07792 | 1.14.14.147 | 3-epi-6-deoxocathasterone,[reduced NADPH---hemoprotein reductase]:oxygen oxidoreductase (C-23-hydroxylating) |
| Rhea:RHEA:27322 | 1.14.14.147 | 3-epi-6-deoxocathasterone + reduced [NADPH—hemoprotein reductase] + O2 => 6-deoxotyphasterol + oxidized [NADPH—hemoprotein reductase] + H2O + H+ |
| Rhea:RHEA:27323 | 1.14.14.147 | 6-deoxotyphasterol + oxidized [NADPH—hemoprotein reductase] + H2O + H+ => 3-epi-6-deoxocathasterone + reduced [NADPH—hemoprotein reductase] + O2 |
| Rhea:RHEA:27324 | 1.14.14.147 | 3-epi-6-deoxocathasterone + reduced [NADPH—hemoprotein reductase] + O2 <=> 6-deoxotyphasterol + oxidized [NADPH—hemoprotein reductase] + H2O + H+ |
| BioCyc:RXN-11532 | 1.1.99.- | Donor-H2 + CPD-3946 --> CPD-12493 + Acceptor |
| BioCyc:RXN-11531 | 1.14.14.- | CPD-12493 + Red-NADPH-Hemoprotein-Reductases + OXYGEN-MOLECULE --> CPD-720 + Ox-NADPH-Hemoprotein-Reductases + WATER |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:META_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| BioCyc:ARA_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| BioCyc:META_PWY-2582 | brassinosteroid biosynthesis II |
| BioCyc:ARA_PWY-2582 | brassinosteroid biosynthesis II |
| PlantCyc:SPENNELLII_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| PlantCyc:SPIRODELA_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:AHALLERI_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:WHEATA_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:WHEATD_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:BARLEY_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| PlantCyc:BOLERACEA_CAPITATA_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:BRACHYPODIUM_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| PlantCyc:BRAPA_FPSC_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:BREADWHEAT_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:CANNUUM_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:CARIETINUM_ICC4958_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:CARIETINUM_ICC4958_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| PlantCyc:CASTORBEAN_PWY-2582 | brassinolide biosynthesis II |
| PlantCyc:CCAPSULARIS_PWY-6544 | superpathway of C28 brassinosteroid biosynthesis |
| PlantCyc:CGRANDIFLORA_PWY-2582 | brassinolide biosynthesis II |